C31H22F6I2N2O4 — CID 139322012
6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-iodopropan-2-yl)phenyl]propan-2-yl]phenyl]-2-(2-iodopropan-2-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 139322012) has the molecular formula C31H22F6I2N2O4 and a molecular weight of 854.32 g/mol. Its IUPAC name is 6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-iodopropan-2-yl)phenyl]propan-2-yl]phenyl]-2-(2-iodopropan-2-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-iodopropan-2-yl)phenyl]propan-2-yl]phenyl]-2-(2-iodopropan-2-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 139322012 |
| Molecular Formula | C31H22F6I2N2O4 |
| Molecular Weight | 854.32 g/mol |
| Exact Mass | 853.96 |
| IUPAC Name | 6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(2-iodopropan-2-yl)phenyl]propan-2-yl]phenyl]-2-(2-iodopropan-2-yl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC(C)(I)c1ccc(C(c2ccc(-n3c(=O)c4cc5c(=O)n(C(C)(C)I)c(=O)c5cc4c3=O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H22F6I2N2O4/c1-27(2,38)15-5-7-16(8-6-15)29(30(32,33)34,31(35,36)37)17-9-11-18(12-10-17)40-23(42)19-13-21-22(14-20(19)24(40)43)26(45)41(25(21)44)28(3,4)39/h5-14H,1-4H3 |
| InChIKey | JDVRUCKCYIZGOW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.32 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|