About (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one
(2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one (PubChem CID 139322380) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one.
Molecular Properties
| Compound Name | (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one |
| PubChem CID | 139322380 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one |
| SMILES | C=C/C(C)=C/C[C@H]1C=CC(=O)[C@@H](C)O1 |
| InChI | InChI=1S/C12H16O2/c1-4-9(2)5-6-11-7-8-12(13)10(3)14-11/h4-5,7-8,10-11H,1,6H2,2-3H3/b9-5+/t10-,11+/m1/s1 |
| InChIKey | SGMUQVBPXDIAQY-DTGHLQKHSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one?
The IUPAC name of (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one (CID 139322380) is (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one.
What is the SMILES notation for (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one?
The canonical SMILES for (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one is C=C/C(C)=C/C[C@H]1C=CC(=O)[C@@H](C)O1.
What is the InChIKey of (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one?
The InChIKey is SGMUQVBPXDIAQY-DTGHLQKHSA-N. The full InChI is InChI=1S/C12H16O2/c1-4-9(2)5-6-11-7-8-12(13)10(3)14-11/h4-5,7-8,10-11H,1,6H2,2-3H3/b9-5+/t10-,11+/m1/s1.
What are the key properties of (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one?
(2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one has a molecular weight of 192.26 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-6-methyl-2-[(2E)-3-methylpenta-2,4-dienyl]-2H-pyran-5-one is sourced from PubChem (CID 139322380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).