C21H16F3N3OS2 — CID 139322419
5,7-dimethyl-6-sulfanylidene-2-[5-(trifluoromethyl)thiophen-3-yl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-4-one (PubChem CID 139322419) has the molecular formula C21H16F3N3OS2 and a molecular weight of 447.51 g/mol. Its IUPAC name is 5,7-dimethyl-6-sulfanylidene-2-[5-(trifluoromethyl)thiophen-3-yl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-4-one.
| Compound Name | 5,7-dimethyl-6-sulfanylidene-2-[5-(trifluoromethyl)thiophen-3-yl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-4-one |
|---|---|
| PubChem CID | 139322419 |
| Molecular Formula | C21H16F3N3OS2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 5,7-dimethyl-6-sulfanylidene-2-[5-(trifluoromethyl)thiophen-3-yl]-5,7,9-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),3(8),11,13,15-pentaen-4-one |
| SMILES | Cn1c2c(c(=O)n(C)c1=S)C(c1csc(C(F)(F)F)c1)C1=C(N2)c2ccccc2C1 |
| InChI | InChI=1S/C21H16F3N3OS2/c1-26-18-16(19(28)27(2)20(26)29)15(11-8-14(30-9-11)21(22,23)24)13-7-10-5-3-4-6-12(10)17(13)25-18/h3-6,8-9,15,25H,7H2,1-2H3 |
| InChIKey | JYGKQOZAGHHOEI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|