About 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole
4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole (PubChem CID 139322701) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole.
Molecular Properties
| Compound Name | 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole |
| PubChem CID | 139322701 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole |
| SMILES | C=CC1=C(/C=C/C(C)C)OCO1 |
| InChI | InChI=1S/C10H14O2/c1-4-9-10(12-7-11-9)6-5-8(2)3/h4-6,8H,1,7H2,2-3H3/b6-5+ |
| InChIKey | YATLIHKVCVXCAW-AATRIKPKSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole?
The IUPAC name of 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole (CID 139322701) is 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole.
What is the SMILES notation for 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole?
The canonical SMILES for 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole is C=CC1=C(/C=C/C(C)C)OCO1.
What is the InChIKey of 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole?
The InChIKey is YATLIHKVCVXCAW-AATRIKPKSA-N. The full InChI is InChI=1S/C10H14O2/c1-4-9-10(12-7-11-9)6-5-8(2)3/h4-6,8H,1,7H2,2-3H3/b6-5+.
What are the key properties of 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole?
4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole has a molecular weight of 166.22 g/mol, XLogP of 2.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyl-5-[(E)-3-methylbut-1-enyl]-1,3-dioxole is sourced from PubChem (CID 139322701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).