C22H21N — CID 139323058
(12E)-2-azatetracyclo[12.9.0.04,9.017,23]tricosa-1(14),2,6,8,12,17(23),21-heptaen-19-yne (PubChem CID 139323058) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is (12E)-2-azatetracyclo[12.9.0.04,9.017,23]tricosa-1(14),2,6,8,12,17(23),21-heptaen-19-yne.
| Compound Name | (12E)-2-azatetracyclo[12.9.0.04,9.017,23]tricosa-1(14),2,6,8,12,17(23),21-heptaen-19-yne |
|---|---|
| PubChem CID | 139323058 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (12E)-2-azatetracyclo[12.9.0.04,9.017,23]tricosa-1(14),2,6,8,12,17(23),21-heptaen-19-yne |
| SMILES | C1#CCC2=C(C=C1)C1=C(/C=C/CCC3=CC=CCC3/C=N/1)CC2 |
| InChI | InChI=1S/C22H21N/c1-2-10-18-14-15-19-11-6-4-8-17-9-5-7-12-20(17)16-23-22(19)21(18)13-3-1/h3,5-7,9,11,13,16,20H,4,8,10,12,14-15H2/b11-6+,23-16+ |
| InChIKey | ZFVLHJRDBLRUCX-YQCVTMEGSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|