C33H29N — CID 139323065
5-(9H-benzo[7]annulen-3-yl)-4-ethenyl-3-[(1E,3Z)-2-methylhexa-1,3,5-trienyl]-2-benzazecine (PubChem CID 139323065) has the molecular formula C33H29N and a molecular weight of 439.60 g/mol. Its IUPAC name is 5-(9H-benzo[7]annulen-3-yl)-4-ethenyl-3-[(1E,3Z)-2-methylhexa-1,3,5-trienyl]-2-benzazecine.
| Compound Name | 5-(9H-benzo[7]annulen-3-yl)-4-ethenyl-3-[(1E,3Z)-2-methylhexa-1,3,5-trienyl]-2-benzazecine |
|---|---|
| PubChem CID | 139323065 |
| Molecular Formula | C33H29N |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 5-(9H-benzo[7]annulen-3-yl)-4-ethenyl-3-[(1E,3Z)-2-methylhexa-1,3,5-trienyl]-2-benzazecine |
| SMILES | C=C/C=C\C(C)=C\c1ncc2ccccc2cccc(-c2ccc3c(c2)C=CC=CC3)c1C=C |
| InChI | InChI=1S/C33H29N/c1-4-6-13-25(3)22-33-31(5-2)32(19-12-18-26-15-10-11-17-30(26)24-34-33)29-21-20-27-14-8-7-9-16-28(27)23-29/h4-13,15-24H,1-2,14H2,3H3/b13-6-,18-12+,19-12+,25-22+,26-18-,30-24-,32-19-,32-31+,33-31-,34-24+,34-33+ |
| InChIKey | QTTGWOXOJYNFBN-LUQSANHOSA-N |
| XLogP | 8.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|