C21H31BrO — CID 139323180
(1Z,2Z,4E)-4-[(2E)-4-bromo-4-methylhepta-2,6-dienylidene]-1-(2-methoxypropylidene)-2-propylidenecyclohexane (PubChem CID 139323180) has the molecular formula C21H31BrO and a molecular weight of 379.38 g/mol. Its IUPAC name is (1Z,2Z,4E)-4-[(2E)-4-bromo-4-methylhepta-2,6-dienylidene]-1-(2-methoxypropylidene)-2-propylidenecyclohexane.
| Compound Name | (1Z,2Z,4E)-4-[(2E)-4-bromo-4-methylhepta-2,6-dienylidene]-1-(2-methoxypropylidene)-2-propylidenecyclohexane |
|---|---|
| PubChem CID | 139323180 |
| Molecular Formula | C21H31BrO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (1Z,2Z,4E)-4-[(2E)-4-bromo-4-methylhepta-2,6-dienylidene]-1-(2-methoxypropylidene)-2-propylidenecyclohexane |
| SMILES | C=CCC(C)(Br)/C=C/C=C1\CCC(=C/C(C)OC)/C(=C\CC)C1 |
| InChI | InChI=1S/C21H31BrO/c1-6-9-19-16-18(10-8-14-21(4,22)13-7-2)11-12-20(19)15-17(3)23-5/h7-10,14-15,17H,2,6,11-13,16H2,1,3-5H3/b14-8+,18-10+,19-9-,20-15- |
| InChIKey | FUEHBZAQKOKXBJ-NNSWVHJLSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|