About 4-oxopentanimidamide
4-oxopentanimidamide (PubChem CID 139323270) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 4-oxopentanimidamide.
Molecular Properties
| Compound Name | 4-oxopentanimidamide |
| PubChem CID | 139323270 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 4-oxopentanimidamide |
| SMILES | [H]/N=C(\N)CCC(C)=O |
| InChI | InChI=1S/C5H10N2O/c1-4(8)2-3-5(6)7/h2-3H2,1H3,(H3,6,7) |
| InChIKey | UNGNQMMRLOJYDI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-oxopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxopentanimidamide?
The IUPAC name of 4-oxopentanimidamide (CID 139323270) is 4-oxopentanimidamide.
What is the SMILES notation for 4-oxopentanimidamide?
The canonical SMILES for 4-oxopentanimidamide is [H]/N=C(\N)CCC(C)=O.
What is the InChIKey of 4-oxopentanimidamide?
The InChIKey is UNGNQMMRLOJYDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-4(8)2-3-5(6)7/h2-3H2,1H3,(H3,6,7).
What are the key properties of 4-oxopentanimidamide?
4-oxopentanimidamide has a molecular weight of 114.15 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxopentanimidamide is sourced from PubChem (CID 139323270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).