C15H21NS — CID 139323714
(2Z,5E,6Z)-5-ethylidene-N,7-dimethyl-4-methylidenedeca-2,6,9-trienethioamide (PubChem CID 139323714) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is (2Z,5E,6Z)-5-ethylidene-N,7-dimethyl-4-methylidenedeca-2,6,9-trienethioamide.
| Compound Name | (2Z,5E,6Z)-5-ethylidene-N,7-dimethyl-4-methylidenedeca-2,6,9-trienethioamide |
|---|---|
| PubChem CID | 139323714 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2Z,5E,6Z)-5-ethylidene-N,7-dimethyl-4-methylidenedeca-2,6,9-trienethioamide |
| SMILES | C=CC/C(C)=C\C(=C/C)C(=C)/C=C\C(=S)NC |
| InChI | InChI=1S/C15H21NS/c1-6-8-12(3)11-14(7-2)13(4)9-10-15(17)16-5/h6-7,9-11H,1,4,8H2,2-3,5H3,(H,16,17)/b10-9-,12-11-,14-7+ |
| InChIKey | HGOGCKVYWBUFAP-DPNXGBPESA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|