C15H21N5 — CID 139323763
(2Z,5E)-5-[(4,5-dimethyl-1H-pyrazol-3-yl)methylidene]-4-methyl-N'-(methylideneamino)hepta-2,6-dienimidamide (PubChem CID 139323763) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is (2Z,5E)-5-[(4,5-dimethyl-1H-pyrazol-3-yl)methylidene]-4-methyl-N'-(methylideneamino)hepta-2,6-dienimidamide.
| Compound Name | (2Z,5E)-5-[(4,5-dimethyl-1H-pyrazol-3-yl)methylidene]-4-methyl-N'-(methylideneamino)hepta-2,6-dienimidamide |
|---|---|
| PubChem CID | 139323763 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (2Z,5E)-5-[(4,5-dimethyl-1H-pyrazol-3-yl)methylidene]-4-methyl-N'-(methylideneamino)hepta-2,6-dienimidamide |
| SMILES | C=C/C(=C\c1n[nH]c(C)c1C)C(C)/C=C\C(N)=NN=C |
| InChI | InChI=1S/C15H21N5/c1-6-13(9-14-11(3)12(4)18-19-14)10(2)7-8-15(16)20-17-5/h6-10H,1,5H2,2-4H3,(H2,16,20)(H,18,19)/b8-7-,13-9+ |
| InChIKey | NRKJNOXNSPOLBJ-XTYDYKDCSA-N |
| XLogP | 2.76 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|