About (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine
(Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine (PubChem CID 139323775) has the molecular formula C14H28FN
and a molecular weight of 229.38 g/mol. Its IUPAC name is (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine.
Molecular Properties
| Compound Name | (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine |
| PubChem CID | 139323775 |
| Molecular Formula | C14H28FN |
| Molecular Weight | 229.38 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine |
| SMILES | CC(C)CC(/C=C\C[C@@H](C)F)C(C)(C)CN |
| InChI | InChI=1S/C14H28FN/c1-11(2)9-13(14(4,5)10-16)8-6-7-12(3)15/h6,8,11-13H,7,9-10,16H2,1-5H3/b8-6-/t12-,13?/m1/s1 |
| InChIKey | KQZBORSYOGTAFP-BWDZVORVSA-N |
| XLogP | 3.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine?
The IUPAC name of (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine (CID 139323775) is (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine.
What is the SMILES notation for (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine?
The canonical SMILES for (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine is CC(C)CC(/C=C\C[C@@H](C)F)C(C)(C)CN.
What is the InChIKey of (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine?
The InChIKey is KQZBORSYOGTAFP-BWDZVORVSA-N. The full InChI is InChI=1S/C14H28FN/c1-11(2)9-13(14(4,5)10-16)8-6-7-12(3)15/h6,8,11-13H,7,9-10,16H2,1-5H3/b8-6-/t12-,13?/m1/s1.
What are the key properties of (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine?
(Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine has a molecular weight of 229.38 g/mol, XLogP of 3.94, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,7R)-7-fluoro-2,2-dimethyl-3-(2-methylpropyl)oct-4-en-1-amine is sourced from PubChem (CID 139323775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).