C21H28FN5 — CID 139323812
(Z)-4-amino-N'-[(Z,3E)-6-fluoro-2,2-dimethyl-3-prop-2-enylidenehept-4-enyl]-4-(2-methylidenepyrimidin-5-ylidene)but-2-enimidamide (PubChem CID 139323812) has the molecular formula C21H28FN5 and a molecular weight of 369.49 g/mol. Its IUPAC name is (Z)-4-amino-N'-[(Z,3E)-6-fluoro-2,2-dimethyl-3-prop-2-enylidenehept-4-enyl]-4-(2-methylidenepyrimidin-5-ylidene)but-2-enimidamide.
| Compound Name | (Z)-4-amino-N'-[(Z,3E)-6-fluoro-2,2-dimethyl-3-prop-2-enylidenehept-4-enyl]-4-(2-methylidenepyrimidin-5-ylidene)but-2-enimidamide |
|---|---|
| PubChem CID | 139323812 |
| Molecular Formula | C21H28FN5 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | (Z)-4-amino-N'-[(Z,3E)-6-fluoro-2,2-dimethyl-3-prop-2-enylidenehept-4-enyl]-4-(2-methylidenepyrimidin-5-ylidene)but-2-enimidamide |
| SMILES | C=C/C=C(\C=C/C(C)F)C(C)(C)C/N=C(N)/C=C\C(N)=c1cnc(=C)nc1 |
| InChI | InChI=1S/C21H28FN5/c1-6-7-18(9-8-15(2)22)21(4,5)14-27-20(24)11-10-19(23)17-12-25-16(3)26-13-17/h6-13,15H,1,3,14,23H2,2,4-5H3,(H2,24,27)/b9-8-,11-10-,18-7+ |
| InChIKey | KLTOYGBXCJGRTD-ZXHHKBAQSA-N |
| XLogP | 1.92 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|