C17H25FS — CID 139323820
(3E,5Z)-4-fluoro-9-[(3Z)-hexa-1,3-dien-2-yl]sulfanyl-8,8-dimethylnona-1,3,5-triene (PubChem CID 139323820) has the molecular formula C17H25FS and a molecular weight of 280.45 g/mol. Its IUPAC name is (3E,5Z)-4-fluoro-9-[(3Z)-hexa-1,3-dien-2-yl]sulfanyl-8,8-dimethylnona-1,3,5-triene.
| Compound Name | (3E,5Z)-4-fluoro-9-[(3Z)-hexa-1,3-dien-2-yl]sulfanyl-8,8-dimethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 139323820 |
| Molecular Formula | C17H25FS |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3E,5Z)-4-fluoro-9-[(3Z)-hexa-1,3-dien-2-yl]sulfanyl-8,8-dimethylnona-1,3,5-triene |
| SMILES | C=C/C=C(F)\C=C/CC(C)(C)CSC(=C)/C=C\CC |
| InChI | InChI=1S/C17H25FS/c1-6-8-11-15(3)19-14-17(4,5)13-9-12-16(18)10-7-2/h7-12H,2-3,6,13-14H2,1,4-5H3/b11-8-,12-9-,16-10+ |
| InChIKey | LHDMJLJQOCUYSM-OAUAOXIVSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|