About (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine
(Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine (PubChem CID 139323914) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine.
Molecular Properties
| Compound Name | (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine |
| PubChem CID | 139323914 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine |
| SMILES | CC[C@H](C)C/C=C\C(C)(N)NC(C)C |
| InChI | InChI=1S/C12H26N2/c1-6-11(4)8-7-9-12(5,13)14-10(2)3/h7,9-11,14H,6,8,13H2,1-5H3/b9-7-/t11-,12?/m0/s1 |
| InChIKey | IOUBSPGKSCVRJI-VGTLBOQDSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine?
The IUPAC name of (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine (CID 139323914) is (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine.
What is the SMILES notation for (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine?
The canonical SMILES for (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine is CC[C@H](C)C/C=C\C(C)(N)NC(C)C.
What is the InChIKey of (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine?
The InChIKey is IOUBSPGKSCVRJI-VGTLBOQDSA-N. The full InChI is InChI=1S/C12H26N2/c1-6-11(4)8-7-9-12(5,13)14-10(2)3/h7,9-11,14H,6,8,13H2,1-5H3/b9-7-/t11-,12?/m0/s1.
What are the key properties of (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine?
(Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,6S)-6-methyl-2-N'-propan-2-yloct-3-ene-2,2-diamine is sourced from PubChem (CID 139323914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).