C10H13N3 — CID 139323966
(2E,4Z)-6-methyl-2-[(methylideneamino)methylidene]hepta-4,6-diene-1,3-diimine (PubChem CID 139323966) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is (2E,4Z)-6-methyl-2-[(methylideneamino)methylidene]hepta-4,6-diene-1,3-diimine.
| Compound Name | (2E,4Z)-6-methyl-2-[(methylideneamino)methylidene]hepta-4,6-diene-1,3-diimine |
|---|---|
| PubChem CID | 139323966 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (2E,4Z)-6-methyl-2-[(methylideneamino)methylidene]hepta-4,6-diene-1,3-diimine |
| SMILES | [H]/N=C(/C=C\C(=C)C)C(/C=N/[H])=C\N=C |
| InChI | InChI=1S/C10H13N3/c1-8(2)4-5-10(12)9(6-11)7-13-3/h4-7,11-12H,1,3H2,2H3/b5-4-,9-7+,11-6+,12-10- |
| InChIKey | SOQWAHGGYBNUSS-KHHIYOONSA-N |
| XLogP | 2.37 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|