C22H32FN3 — CID 139323986
(7Z)-N-[2-(4-fluorocyclohepta-1,3,5-trien-1-yl)-2-methylpropyl]-5,6-bis(methylimino)nona-1,7-dien-2-amine (PubChem CID 139323986) has the molecular formula C22H32FN3 and a molecular weight of 357.52 g/mol. Its IUPAC name is (7Z)-N-[2-(4-fluorocyclohepta-1,3,5-trien-1-yl)-2-methylpropyl]-5,6-bis(methylimino)nona-1,7-dien-2-amine.
| Compound Name | (7Z)-N-[2-(4-fluorocyclohepta-1,3,5-trien-1-yl)-2-methylpropyl]-5,6-bis(methylimino)nona-1,7-dien-2-amine |
|---|---|
| PubChem CID | 139323986 |
| Molecular Formula | C22H32FN3 |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.26 |
| IUPAC Name | (7Z)-N-[2-(4-fluorocyclohepta-1,3,5-trien-1-yl)-2-methylpropyl]-5,6-bis(methylimino)nona-1,7-dien-2-amine |
| SMILES | C=C(CCC(=N/C)/C(/C=C\C)=N/C)NCC(C)(C)C1=CC=C(F)C=CC1 |
| InChI | InChI=1S/C22H32FN3/c1-7-9-20(24-5)21(25-6)15-12-17(2)26-16-22(3,4)18-10-8-11-19(23)14-13-18/h7-9,11,13-14,26H,2,10,12,15-16H2,1,3-6H3/b9-7-,24-20+,25-21- |
| InChIKey | MXNBWBXNUBCCQT-NEXHWDOMSA-N |
| XLogP | 5.35 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|