C37H42N2O7S — CID 139324129
2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hexa-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid (PubChem CID 139324129) has the molecular formula C37H42N2O7S and a molecular weight of 658.82 g/mol. Its IUPAC name is 2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hexa-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hexa-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 139324129 |
| Molecular Formula | C37H42N2O7S |
| Molecular Weight | 658.82 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 2-[[4-[3-amino-2-[4-(2,2-dimethylpropoxy)phenyl]-3-oxopropyl]-2-[(2E,4E)-5-(1-benzofuran-2-yl)hexa-2,4-dien-3-yl]benzoyl]amino]ethanesulfonic acid |
| SMILES | C/C=C(\C=C(/C)c1cc2ccccc2o1)c1cc(CC(C(N)=O)c2ccc(OCC(C)(C)C)cc2)ccc1C(=O)NCCS(=O)(=O)O |
| InChI | InChI=1S/C37H42N2O7S/c1-6-26(19-24(2)34-22-28-9-7-8-10-33(28)46-34)31-20-25(11-16-30(31)36(41)39-17-18-47(42,43)44)21-32(35(38)40)27-12-14-29(15-13-27)45-23-37(3,4)5/h6-16,19-20,22,32H,17-18,21,23H2,1-5H3,(H2,38,40)(H,39,41)(H,42,43,44)/b24-19+,26-6+ |
| InChIKey | DTGRKRRPIJUKKX-MTTIKJHBSA-N |
| XLogP | 6.79 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.82 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|