About 2-methyl-2,7a-dihydro-1H-benzimidazole
2-methyl-2,7a-dihydro-1H-benzimidazole (PubChem CID 139324229) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 2-methyl-2,7a-dihydro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-methyl-2,7a-dihydro-1H-benzimidazole |
| PubChem CID | 139324229 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 2-methyl-2,7a-dihydro-1H-benzimidazole |
| SMILES | CC1N=C2C=CC=CC2N1 |
| InChI | InChI=1S/C8H10N2/c1-6-9-7-4-2-3-5-8(7)10-6/h2-7,9H,1H3 |
| InChIKey | LZMGXSXCDAACPT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-2,7a-dihydro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,7a-dihydro-1H-benzimidazole?
The IUPAC name of 2-methyl-2,7a-dihydro-1H-benzimidazole (CID 139324229) is 2-methyl-2,7a-dihydro-1H-benzimidazole.
What is the SMILES notation for 2-methyl-2,7a-dihydro-1H-benzimidazole?
The canonical SMILES for 2-methyl-2,7a-dihydro-1H-benzimidazole is CC1N=C2C=CC=CC2N1.
What is the InChIKey of 2-methyl-2,7a-dihydro-1H-benzimidazole?
The InChIKey is LZMGXSXCDAACPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-9-7-4-2-3-5-8(7)10-6/h2-7,9H,1H3.
What are the key properties of 2-methyl-2,7a-dihydro-1H-benzimidazole?
2-methyl-2,7a-dihydro-1H-benzimidazole has a molecular weight of 134.18 g/mol, XLogP of 0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,7a-dihydro-1H-benzimidazole is sourced from PubChem (CID 139324229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).