About 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine
1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine (PubChem CID 139324365) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine |
| PubChem CID | 139324365 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine |
| SMILES | C=C(C)/C=C/CN1CCCC1 |
| InChI | InChI=1S/C10H17N/c1-10(2)6-5-9-11-7-3-4-8-11/h5-6H,1,3-4,7-9H2,2H3/b6-5+ |
| InChIKey | NIEYBGMXPHTEKD-AATRIKPKSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine?
The IUPAC name of 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine (CID 139324365) is 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine.
What is the SMILES notation for 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine?
The canonical SMILES for 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine is C=C(C)/C=C/CN1CCCC1.
What is the InChIKey of 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine?
The InChIKey is NIEYBGMXPHTEKD-AATRIKPKSA-N. The full InChI is InChI=1S/C10H17N/c1-10(2)6-5-9-11-7-3-4-8-11/h5-6H,1,3-4,7-9H2,2H3/b6-5+.
What are the key properties of 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine?
1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine has a molecular weight of 151.25 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-4-methylpenta-2,4-dienyl]pyrrolidine is sourced from PubChem (CID 139324365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).