C15H24N4O2 — CID 139324383
N-(1-aminoethyl)-2-[(3R)-3-hydroxypiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide (PubChem CID 139324383) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[(3R)-3-hydroxypiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[(3R)-3-hydroxypiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 139324383 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | N-(1-aminoethyl)-2-[(3R)-3-hydroxypiperidin-1-yl]-5,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)N)c(N2CCC[C@@H](O)C2)nc1C |
| InChI | InChI=1S/C15H24N4O2/c1-9-7-13(15(21)18-11(3)16)14(17-10(9)2)19-6-4-5-12(20)8-19/h7,11-12,20H,4-6,8,16H2,1-3H3,(H,18,21)/t11?,12-/m1/s1 |
| InChIKey | WZOQYAIYSMICSR-PIJUOVFKSA-N |
| XLogP | 0.69 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|