C25H31N5O4 — CID 139324963
(4R)-4-[1-[6-[1-[(3S,3aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]pyrazol-4-yl]-2,3-dimethylindazol-4-yl]oxyethyl]pyrrolidin-2-one (PubChem CID 139324963) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is (4R)-4-[1-[6-[1-[(3S,3aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]pyrazol-4-yl]-2,3-dimethylindazol-4-yl]oxyethyl]pyrrolidin-2-one.
| Compound Name | (4R)-4-[1-[6-[1-[(3S,3aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]pyrazol-4-yl]-2,3-dimethylindazol-4-yl]oxyethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 139324963 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | (4R)-4-[1-[6-[1-[(3S,3aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-3-yl]pyrazol-4-yl]-2,3-dimethylindazol-4-yl]oxyethyl]pyrrolidin-2-one |
| SMILES | Cc1c2c(OC(C)[C@H]3CNC(=O)C3)cc(-c3cnn([C@H]4COC5CCCO[C@@H]54)c3)cc2nn1C |
| InChI | InChI=1S/C25H31N5O4/c1-14-24-19(28-29(14)3)7-16(8-22(24)34-15(2)17-9-23(31)26-10-17)18-11-27-30(12-18)20-13-33-21-5-4-6-32-25(20)21/h7-8,11-12,15,17,20-21,25H,4-6,9-10,13H2,1-3H3,(H,26,31)/t15?,17-,20+,21?,25-/m1/s1 |
| InChIKey | QBVQYGZHFSHGTQ-MEFPPBIVSA-N |
| XLogP | 2.77 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |