C12H23N3 — CID 139324978
1-[(2E,4Z)-2,4-dimethylhexa-2,4-dienyl]-1-propylguanidine (PubChem CID 139324978) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 1-[(2E,4Z)-2,4-dimethylhexa-2,4-dienyl]-1-propylguanidine.
| Compound Name | 1-[(2E,4Z)-2,4-dimethylhexa-2,4-dienyl]-1-propylguanidine |
|---|---|
| PubChem CID | 139324978 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1-[(2E,4Z)-2,4-dimethylhexa-2,4-dienyl]-1-propylguanidine |
| SMILES | [H]/N=C(\N)N(CCC)C/C(C)=C/C(C)=C\C |
| InChI | InChI=1S/C12H23N3/c1-5-7-15(12(13)14)9-11(4)8-10(3)6-2/h6,8H,5,7,9H2,1-4H3,(H3,13,14)/b10-6-,11-8+ |
| InChIKey | BLIXLWMEEYFXRB-YANFREPOSA-N |
| XLogP | 2.50 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|