C19H39NO5 — CID 139325403
6-[[(E)-2,4-diethyloct-2-enyl]-methylamino]hexane-1,2,3,4,5-pentol (PubChem CID 139325403) has the molecular formula C19H39NO5 and a molecular weight of 361.52 g/mol. Its IUPAC name is 6-[[(E)-2,4-diethyloct-2-enyl]-methylamino]hexane-1,2,3,4,5-pentol.
| Compound Name | 6-[[(E)-2,4-diethyloct-2-enyl]-methylamino]hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 139325403 |
| Molecular Formula | C19H39NO5 |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | 6-[[(E)-2,4-diethyloct-2-enyl]-methylamino]hexane-1,2,3,4,5-pentol |
| SMILES | CCCCC(/C=C(\CC)CN(C)CC(O)C(O)C(O)C(O)CO)CC |
| InChI | InChI=1S/C19H39NO5/c1-5-8-9-14(6-2)10-15(7-3)11-20(4)12-16(22)18(24)19(25)17(23)13-21/h10,14,16-19,21-25H,5-9,11-13H2,1-4H3/b15-10+ |
| InChIKey | IVQNJNGRRUOJIR-XNTDXEJSSA-N |
| XLogP | 0.91 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|