C31H62N4 — CID 139325508
1-N-[(7R)-5-ethyl-7,11-dimethyl-4-propyldodeca-1,10-dien-2-yl]-4-N-(7-hydrazinylheptyl)pent-4-ene-1,4-diamine (PubChem CID 139325508) has the molecular formula C31H62N4 and a molecular weight of 490.87 g/mol. Its IUPAC name is 1-N-[(7R)-5-ethyl-7,11-dimethyl-4-propyldodeca-1,10-dien-2-yl]-4-N-(7-hydrazinylheptyl)pent-4-ene-1,4-diamine.
| Compound Name | 1-N-[(7R)-5-ethyl-7,11-dimethyl-4-propyldodeca-1,10-dien-2-yl]-4-N-(7-hydrazinylheptyl)pent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 139325508 |
| Molecular Formula | C31H62N4 |
| Molecular Weight | 490.87 g/mol |
| Exact Mass | 490.50 |
| IUPAC Name | 1-N-[(7R)-5-ethyl-7,11-dimethyl-4-propyldodeca-1,10-dien-2-yl]-4-N-(7-hydrazinylheptyl)pent-4-ene-1,4-diamine |
| SMILES | C=C(CCCNC(=C)CC(CCC)C(CC)C[C@H](C)CCC=C(C)C)NCCCCCCCNN |
| InChI | InChI=1S/C31H62N4/c1-8-17-31(30(9-2)24-27(5)19-15-18-26(3)4)25-29(7)34-22-16-20-28(6)33-21-13-11-10-12-14-23-35-32/h18,27,30-31,33-35H,6-17,19-25,32H2,1-5H3/t27-,30?,31?/m1/s1 |
| InChIKey | OMGCJDVURWZKEP-MRAVXTPNSA-N |
| XLogP | 7.99 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.87 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|