C10H21F2NO2S2 — CID 139325565
N-(1,1-difluoroethyl)-2,2,3-trimethyl-3-sulfanylpentane-1-sulfonamide (PubChem CID 139325565) has the molecular formula C10H21F2NO2S2 and a molecular weight of 289.41 g/mol. Its IUPAC name is N-(1,1-difluoroethyl)-2,2,3-trimethyl-3-sulfanylpentane-1-sulfonamide.
| Compound Name | N-(1,1-difluoroethyl)-2,2,3-trimethyl-3-sulfanylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 139325565 |
| Molecular Formula | C10H21F2NO2S2 |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(1,1-difluoroethyl)-2,2,3-trimethyl-3-sulfanylpentane-1-sulfonamide |
| SMILES | CCC(C)(S)C(C)(C)CS(=O)(=O)NC(C)(F)F |
| InChI | InChI=1S/C10H21F2NO2S2/c1-6-9(4,16)8(2,3)7-17(14,15)13-10(5,11)12/h13,16H,6-7H2,1-5H3 |
| InChIKey | HSFRFLZLZQGWSH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|