C12H25F2NO2S — CID 139325592
N-(1,1-difluoroethyl)-2,2,4,4-tetramethylhexane-1-sulfonamide (PubChem CID 139325592) has the molecular formula C12H25F2NO2S and a molecular weight of 285.40 g/mol. Its IUPAC name is N-(1,1-difluoroethyl)-2,2,4,4-tetramethylhexane-1-sulfonamide.
| Compound Name | N-(1,1-difluoroethyl)-2,2,4,4-tetramethylhexane-1-sulfonamide |
|---|---|
| PubChem CID | 139325592 |
| Molecular Formula | C12H25F2NO2S |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-(1,1-difluoroethyl)-2,2,4,4-tetramethylhexane-1-sulfonamide |
| SMILES | CCC(C)(C)CC(C)(C)CS(=O)(=O)NC(C)(F)F |
| InChI | InChI=1S/C12H25F2NO2S/c1-7-10(2,3)8-11(4,5)9-18(16,17)15-12(6,13)14/h15H,7-9H2,1-6H3 |
| InChIKey | YXWOHJLFVPWVGW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|