C25H42O5 — CID 139325736
(4R)-4-[(12R,16S)-3,7,12-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 139325736) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is (4R)-4-[(12R,16S)-3,7,12-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(12R,16S)-3,7,12-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 139325736 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | (4R)-4-[(12R,16S)-3,7,12-trihydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | CC(CCC(=O)O)C1[C@@H](C)CC2C3C(O)CC4CC(O)CCC4(C)C3C[C@@H](O)C21C |
| InChI | InChI=1S/C25H42O5/c1-13(5-6-21(29)30)23-14(2)9-18-22-17(12-20(28)25(18,23)4)24(3)8-7-16(26)10-15(24)11-19(22)27/h13-20,22-23,26-28H,5-12H2,1-4H3,(H,29,30)/t13?,14-,15?,16?,17?,18?,19?,20+,22?,23?,24?,25?/m0/s1 |
| InChIKey | ROJLXRCJRIMSOM-FGBRQCOSSA-N |
| XLogP | 3.69 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |