C26H35FN4O3 — CID 139325956
(2S,3S,4R)-1-acetyl-2-ethyl-4-[(5-fluoro-4-methyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]-3-methyl-N-(oxan-4-yl)-3,4-dihydro-2H-quinoline-6-carboxamide (PubChem CID 139325956) has the molecular formula C26H35FN4O3 and a molecular weight of 470.59 g/mol. Its IUPAC name is (2S,3S,4R)-1-acetyl-2-ethyl-4-[(5-fluoro-4-methyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]-3-methyl-N-(oxan-4-yl)-3,4-dihydro-2H-quinoline-6-carboxamide.
| Compound Name | (2S,3S,4R)-1-acetyl-2-ethyl-4-[(5-fluoro-4-methyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]-3-methyl-N-(oxan-4-yl)-3,4-dihydro-2H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 139325956 |
| Molecular Formula | C26H35FN4O3 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (2S,3S,4R)-1-acetyl-2-ethyl-4-[(5-fluoro-4-methyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]-3-methyl-N-(oxan-4-yl)-3,4-dihydro-2H-quinoline-6-carboxamide |
| SMILES | CC[C@H]1[C@H](C)[C@@H](/N=C2\CC(C)C(F)=CN2)c2cc(C(=O)NC3CCOCC3)ccc2N1C(C)=O |
| InChI | InChI=1S/C26H35FN4O3/c1-5-22-16(3)25(30-24-12-15(2)21(27)14-28-24)20-13-18(6-7-23(20)31(22)17(4)32)26(33)29-19-8-10-34-11-9-19/h6-7,13-16,19,22,25H,5,8-12H2,1-4H3,(H,28,30)(H,29,33)/t15?,16-,22-,25+/m0/s1 |
| InChIKey | BGOQMTTUKYXBJX-LTQZPNCQSA-N |
| XLogP | 4.26 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|