C17H20FN3O2 — CID 139326002
1-[(2S)-2-fluoro-6-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone (PubChem CID 139326002) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-[(2S)-2-fluoro-6-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-fluoro-6-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 139326002 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-[(2S)-2-fluoro-6-[1-(2-hydroxyethyl)pyrazol-4-yl]-3-methyl-3,4-dihydro-2H-quinolin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(-c3cnn(CCO)c3)cc2CC(C)[C@@H]1F |
| InChI | InChI=1S/C17H20FN3O2/c1-11-7-14-8-13(15-9-19-20(10-15)5-6-22)3-4-16(14)21(12(2)23)17(11)18/h3-4,8-11,17,22H,5-7H2,1-2H3/t11?,17-/m1/s1 |
| InChIKey | GUMRXHNPGHWVFS-DFDFJRDNSA-N |
| XLogP | 2.38 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|