C20H42N2 — CID 139326123
1-N-methyl-2-N-(3,3,4,4,10-pentamethylundec-10-enyl)propane-1,2-diamine (PubChem CID 139326123) has the molecular formula C20H42N2 and a molecular weight of 310.57 g/mol. Its IUPAC name is 1-N-methyl-2-N-(3,3,4,4,10-pentamethylundec-10-enyl)propane-1,2-diamine.
| Compound Name | 1-N-methyl-2-N-(3,3,4,4,10-pentamethylundec-10-enyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 139326123 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | 1-N-methyl-2-N-(3,3,4,4,10-pentamethylundec-10-enyl)propane-1,2-diamine |
| SMILES | C=C(C)CCCCCC(C)(C)C(C)(C)CCNC(C)CNC |
| InChI | InChI=1S/C20H42N2/c1-17(2)12-10-9-11-13-19(4,5)20(6,7)14-15-22-18(3)16-21-8/h18,21-22H,1,9-16H2,2-8H3 |
| InChIKey | ASFJULHGOPIQNJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|