About 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile
4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile (PubChem CID 139326351) has the molecular formula C17H13N
and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile.
Molecular Properties
| Compound Name | 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile |
| PubChem CID | 139326351 |
| Molecular Formula | C17H13N |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile |
| SMILES | N#CC1Cc2ccc(/C=C/c3ccccc3)cc21 |
| InChI | InChI=1S/C17H13N/c18-12-16-11-15-9-8-14(10-17(15)16)7-6-13-4-2-1-3-5-13/h1-10,16H,11H2/b7-6+ |
| InChIKey | HACPGVSNSVPBCK-VOTSOKGWSA-N |
| XLogP | 4.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile?
The IUPAC name of 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile (CID 139326351) is 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile.
What is the SMILES notation for 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile?
The canonical SMILES for 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile is N#CC1Cc2ccc(/C=C/c3ccccc3)cc21.
What is the InChIKey of 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile?
The InChIKey is HACPGVSNSVPBCK-VOTSOKGWSA-N. The full InChI is InChI=1S/C17H13N/c18-12-16-11-15-9-8-14(10-17(15)16)7-6-13-4-2-1-3-5-13/h1-10,16H,11H2/b7-6+.
What are the key properties of 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile?
4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile has a molecular weight of 231.30 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-phenylethenyl]bicyclo[4.2.0]octa-1(6),2,4-triene-7-carbonitrile is sourced from PubChem (CID 139326351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).