About 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole
7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole (PubChem CID 139326671) has the molecular formula C25H23N5S
and a molecular weight of 425.56 g/mol. Its IUPAC name is 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole |
| PubChem CID | 139326671 |
| Molecular Formula | C25H23N5S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole |
| SMILES | CN1CCN(c2ccc(-c3ccn4c(-c5cccc6ncsc56)cnc4c3)cc2)CC1 |
| InChI | InChI=1S/C25H23N5S/c1-28-11-13-29(14-12-28)20-7-5-18(6-8-20)19-9-10-30-23(16-26-24(30)15-19)21-3-2-4-22-25(21)31-17-27-22/h2-10,15-17H,11-14H2,1H3 |
| InChIKey | DQFRITSUHMXWME-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 36.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole?
The IUPAC name of 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole (CID 139326671) is 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole.
What is the SMILES notation for 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole?
The canonical SMILES for 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole is CN1CCN(c2ccc(-c3ccn4c(-c5cccc6ncsc56)cnc4c3)cc2)CC1.
What is the InChIKey of 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole?
The InChIKey is DQFRITSUHMXWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N5S/c1-28-11-13-29(14-12-28)20-7-5-18(6-8-20)19-9-10-30-23(16-26-24(30)15-19)21-3-2-4-22-25(21)31-17-27-22/h2-10,15-17H,11-14H2,1H3.
What are the key properties of 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole?
7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole has a molecular weight of 425.56 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[7-[4-(4-methylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyridin-3-yl]-1,3-benzothiazole is sourced from PubChem (CID 139326671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).