C29H32FNO4 — CID 139328894
(6S)-6-tert-butyl-10-(4-fluorophenyl)-9-(4-methoxybutyl)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 139328894) has the molecular formula C29H32FNO4 and a molecular weight of 477.58 g/mol. Its IUPAC name is (6S)-6-tert-butyl-10-(4-fluorophenyl)-9-(4-methoxybutyl)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | (6S)-6-tert-butyl-10-(4-fluorophenyl)-9-(4-methoxybutyl)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 139328894 |
| Molecular Formula | C29H32FNO4 |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | (6S)-6-tert-butyl-10-(4-fluorophenyl)-9-(4-methoxybutyl)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COCCCCc1cc2c(cc1-c1ccc(F)cc1)-c1cc(=O)c(C(=O)O)cn1[C@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C29H32FNO4/c1-29(2,3)27-14-20-13-19(7-5-6-12-35-4)22(18-8-10-21(30)11-9-18)15-23(20)25-16-26(32)24(28(33)34)17-31(25)27/h8-11,13,15-17,27H,5-7,12,14H2,1-4H3,(H,33,34)/t27-/m0/s1 |
| InChIKey | RPVDAGWZHCJIPS-MHZLTWQESA-N |
| XLogP | 6.13 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|