About 7H-purine-3,4-diamine
7H-purine-3,4-diamine (PubChem CID 139329286) has the molecular formula C5H8N6
and a molecular weight of 152.16 g/mol. Its IUPAC name is 7H-purine-3,4-diamine.
Molecular Properties
| Compound Name | 7H-purine-3,4-diamine |
| PubChem CID | 139329286 |
| Molecular Formula | C5H8N6 |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 7H-purine-3,4-diamine |
| SMILES | NN1C=NC=C2NC=NC21N |
| InChI | InChI=1S/C5H8N6/c6-5-4(9-2-10-5)1-8-3-11(5)7/h1-3H,6-7H2,(H,9,10) |
| InChIKey | RWGPJWKKCGOUAW-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 92.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 7H-purine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine-3,4-diamine?
The IUPAC name of 7H-purine-3,4-diamine (CID 139329286) is 7H-purine-3,4-diamine.
What is the SMILES notation for 7H-purine-3,4-diamine?
The canonical SMILES for 7H-purine-3,4-diamine is NN1C=NC=C2NC=NC21N.
What is the InChIKey of 7H-purine-3,4-diamine?
The InChIKey is RWGPJWKKCGOUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6/c6-5-4(9-2-10-5)1-8-3-11(5)7/h1-3H,6-7H2,(H,9,10).
What are the key properties of 7H-purine-3,4-diamine?
7H-purine-3,4-diamine has a molecular weight of 152.16 g/mol, XLogP of -1.71, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-3,4-diamine is sourced from PubChem (CID 139329286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).