C22H30N4O — CID 139329299
N-(8-benzyl-1,2,5,6,6a,7,9,10-octahydropyrazino[1,2-a][1,8]naphthyridin-4-yl)butanamide (PubChem CID 139329299) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is N-(8-benzyl-1,2,5,6,6a,7,9,10-octahydropyrazino[1,2-a][1,8]naphthyridin-4-yl)butanamide.
| Compound Name | N-(8-benzyl-1,2,5,6,6a,7,9,10-octahydropyrazino[1,2-a][1,8]naphthyridin-4-yl)butanamide |
|---|---|
| PubChem CID | 139329299 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-(8-benzyl-1,2,5,6,6a,7,9,10-octahydropyrazino[1,2-a][1,8]naphthyridin-4-yl)butanamide |
| SMILES | CCCC(=O)NC1=CCNC2=C1CCC1CN(Cc3ccccc3)CCN21 |
| InChI | InChI=1S/C22H30N4O/c1-2-6-21(27)24-20-11-12-23-22-19(20)10-9-18-16-25(13-14-26(18)22)15-17-7-4-3-5-8-17/h3-5,7-8,11,18,23H,2,6,9-10,12-16H2,1H3,(H,24,27) |
| InChIKey | AVBWKZPQDBOFKS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |