C12H11N5O6S — CID 139329360
[2-[3-(1,3-oxazol-2-yl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate (PubChem CID 139329360) has the molecular formula C12H11N5O6S and a molecular weight of 353.32 g/mol. Its IUPAC name is [2-[3-(1,3-oxazol-2-yl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate.
| Compound Name | [2-[3-(1,3-oxazol-2-yl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 139329360 |
| Molecular Formula | C12H11N5O6S |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | [2-[3-(1,3-oxazol-2-yl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
| SMILES | O=C1N2CC(C=CC2n2ccc(-c3ncco3)n2)N1OS(=O)(=O)O |
| InChI | InChI=1S/C12H11N5O6S/c18-12-15-7-8(17(12)23-24(19,20)21)1-2-10(15)16-5-3-9(14-16)11-13-4-6-22-11/h1-6,8,10H,7H2,(H,19,20,21) |
| InChIKey | JKVXJMKGBLXPDJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|