C17H17N7O4S — CID 139329392
[(E)-[1-(7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)pyrazol-3-yl]methylideneamino]-(1,3-thiazol-2-yl)carbamic acid (PubChem CID 139329392) has the molecular formula C17H17N7O4S and a molecular weight of 415.44 g/mol. Its IUPAC name is [(E)-[1-(7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)pyrazol-3-yl]methylideneamino]-(1,3-thiazol-2-yl)carbamic acid.
| Compound Name | [(E)-[1-(7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)pyrazol-3-yl]methylideneamino]-(1,3-thiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 139329392 |
| Molecular Formula | C17H17N7O4S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [(E)-[1-(7-oxo-6-prop-2-enoxy-1,6-diazabicyclo[3.2.1]oct-3-en-3-yl)pyrazol-3-yl]methylideneamino]-(1,3-thiazol-2-yl)carbamic acid |
| SMILES | C=CCON1C(=O)N2CC(n3ccc(/C=N/N(C(=O)O)c4nccs4)n3)=CC1C2 |
| InChI | InChI=1S/C17H17N7O4S/c1-2-6-28-24-14-8-13(10-21(11-14)16(24)25)22-5-3-12(20-22)9-19-23(17(26)27)15-18-4-7-29-15/h2-5,7-9,14H,1,6,10-11H2,(H,26,27)/b19-9+ |
| InChIKey | DZKGHABWIFXPJC-DJKKODMXSA-N |
| XLogP | 1.94 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|