C24H28N10O10S — CID 139329397
bis[3-[3-(2-hydroxyethylcarbamoyl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate (PubChem CID 139329397) has the molecular formula C24H28N10O10S and a molecular weight of 648.61 g/mol. Its IUPAC name is bis[3-[3-(2-hydroxyethylcarbamoyl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate.
| Compound Name | bis[3-[3-(2-hydroxyethylcarbamoyl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
|---|---|
| PubChem CID | 139329397 |
| Molecular Formula | C24H28N10O10S |
| Molecular Weight | 648.61 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | bis[3-[3-(2-hydroxyethylcarbamoyl)pyrazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] sulfate |
| SMILES | O=C(NCCO)c1ccn(C2=CC3CN(C2)C(=O)N3OS(=O)(=O)ON2C(=O)N3CC(n4ccc(C(=O)NCCO)n4)=CC2C3)n1 |
| InChI | InChI=1S/C24H28N10O10S/c35-7-3-25-21(37)19-1-5-31(27-19)15-9-17-13-29(11-15)23(39)33(17)43-45(41,42)44-34-18-10-16(12-30(14-18)24(34)40)32-6-2-20(28-32)22(38)26-4-8-36/h1-2,5-6,9-10,17-18,35-36H,3-4,7-8,11-14H2,(H,25,37)(H,26,38) |
| InChIKey | DOBYCRUAPMFRKG-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 234.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.61 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |