C11H15N7O7S — CID 139329405
[3-[4-(2-aminoethoxycarbamoyl)triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate (PubChem CID 139329405) has the molecular formula C11H15N7O7S and a molecular weight of 389.35 g/mol. Its IUPAC name is [3-[4-(2-aminoethoxycarbamoyl)triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate.
| Compound Name | [3-[4-(2-aminoethoxycarbamoyl)triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 139329405 |
| Molecular Formula | C11H15N7O7S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | [3-[4-(2-aminoethoxycarbamoyl)triazol-1-yl]-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
| SMILES | NCCONC(=O)c1cn(C2=CC3CN(C2)C(=O)N3OS(=O)(=O)O)nn1 |
| InChI | InChI=1S/C11H15N7O7S/c12-1-2-24-14-10(19)9-6-17(15-13-9)7-3-8-5-16(4-7)11(20)18(8)25-26(21,22)23/h3,6,8H,1-2,4-5,12H2,(H,14,19)(H,21,22,23) |
| InChIKey | BHGDWFHJHUAQJN-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 182.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|