C13H20N2O3 — CID 139329495
1-butyl-5-ethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 139329495) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-butyl-5-ethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-butyl-5-ethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 139329495 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-butyl-5-ethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(CC)C(=O)NC(=O)N(CCCC)C1=O |
| InChI | InChI=1S/C13H20N2O3/c1-4-7-9-15-11(17)13(6-3,8-5-2)10(16)14-12(15)18/h5H,2,4,6-9H2,1,3H3,(H,14,16,18) |
| InChIKey | QNGPMNSOHVLAON-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|