About 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile
3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile (PubChem CID 139329551) has the molecular formula C17H17F2N3O
and a molecular weight of 317.34 g/mol. Its IUPAC name is 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile.
Molecular Properties
| Compound Name | 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile |
| PubChem CID | 139329551 |
| Molecular Formula | C17H17F2N3O |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile |
| SMILES | CC1(C(O)(Cc2ccc(F)cc2F)Cn2cncc2C#N)CC1 |
| InChI | InChI=1S/C17H17F2N3O/c1-16(4-5-16)17(23,10-22-11-21-9-14(22)8-20)7-12-2-3-13(18)6-15(12)19/h2-3,6,9,11,23H,4-5,7,10H2,1H3 |
| InChIKey | HPZHYFDOTPHJQL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile?
The IUPAC name of 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile (CID 139329551) is 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile.
What is the SMILES notation for 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile?
The canonical SMILES for 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile is CC1(C(O)(Cc2ccc(F)cc2F)Cn2cncc2C#N)CC1.
What is the InChIKey of 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile?
The InChIKey is HPZHYFDOTPHJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N3O/c1-16(4-5-16)17(23,10-22-11-21-9-14(22)8-20)7-12-2-3-13(18)6-15(12)19/h2-3,6,9,11,23H,4-5,7,10H2,1H3.
What are the key properties of 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile?
3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile has a molecular weight of 317.34 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2,4-difluorophenyl)-2-hydroxy-2-(1-methylcyclopropyl)propyl]imidazole-4-carbonitrile is sourced from PubChem (CID 139329551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).