About N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine
N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine (PubChem CID 139329612) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine.
Molecular Properties
| Compound Name | N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine |
| PubChem CID | 139329612 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine |
| SMILES | Cc1ccc(Nc2nccnn2)o1 |
| InChI | InChI=1S/C8H8N4O/c1-6-2-3-7(13-6)11-8-9-4-5-10-12-8/h2-5H,1H3,(H,9,11,12) |
| InChIKey | FRKYGKZWBHKSFY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine?
The IUPAC name of N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine (CID 139329612) is N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine.
What is the SMILES notation for N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine?
The canonical SMILES for N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine is Cc1ccc(Nc2nccnn2)o1.
What is the InChIKey of N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine?
The InChIKey is FRKYGKZWBHKSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O/c1-6-2-3-7(13-6)11-8-9-4-5-10-12-8/h2-5H,1H3,(H,9,11,12).
What are the key properties of N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine?
N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine has a molecular weight of 176.18 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methylfuran-2-yl)-1,2,4-triazin-3-amine is sourced from PubChem (CID 139329612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).