C12H13NO — CID 139329814
2,3,4,4a,5,6-hexahydrocarbazol-1-one (PubChem CID 139329814) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydrocarbazol-1-one.
| Compound Name | 2,3,4,4a,5,6-hexahydrocarbazol-1-one |
|---|---|
| PubChem CID | 139329814 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2,3,4,4a,5,6-hexahydrocarbazol-1-one |
| SMILES | O=C1CCCC2C1=NC1=C2CCC=C1 |
| InChI | InChI=1S/C12H13NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h2,6,9H,1,3-5,7H2 |
| InChIKey | FKRHZNBUYXOQEV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |