C27H12F9N3O3 — CID 139330725
2,4,6-tris(2,4,5-trifluorophenyl)benzene-1,3,5-tricarboxamide (PubChem CID 139330725) has the molecular formula C27H12F9N3O3 and a molecular weight of 597.39 g/mol. Its IUPAC name is 2,4,6-tris(2,4,5-trifluorophenyl)benzene-1,3,5-tricarboxamide.
| Compound Name | 2,4,6-tris(2,4,5-trifluorophenyl)benzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 139330725 |
| Molecular Formula | C27H12F9N3O3 |
| Molecular Weight | 597.39 g/mol |
| Exact Mass | 597.07 |
| IUPAC Name | 2,4,6-tris(2,4,5-trifluorophenyl)benzene-1,3,5-tricarboxamide |
| SMILES | NC(=O)c1c(-c2cc(F)c(F)cc2F)c(C(N)=O)c(-c2cc(F)c(F)cc2F)c(C(N)=O)c1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C27H12F9N3O3/c28-10-4-16(34)13(31)1-7(10)19-22(25(37)40)20(8-2-14(32)17(35)5-11(8)29)24(27(39)42)21(23(19)26(38)41)9-3-15(33)18(36)6-12(9)30/h1-6H,(H2,37,40)(H2,38,41)(H2,39,42) |
| InChIKey | PBKJNPGMTKKQLP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|