About 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde
2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde (PubChem CID 139331224) has the molecular formula C9H9Cl2NO3
and a molecular weight of 250.08 g/mol. Its IUPAC name is 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde.
Molecular Properties
| Compound Name | 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde |
| PubChem CID | 139331224 |
| Molecular Formula | C9H9Cl2NO3 |
| Molecular Weight | 250.08 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde |
| SMILES | COC(C=O)(OC)c1c(Cl)ccnc1Cl |
| InChI | InChI=1S/C9H9Cl2NO3/c1-14-9(5-13,15-2)7-6(10)3-4-12-8(7)11/h3-5H,1-2H3 |
| InChIKey | XFDDQORETRNHPS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde?
The IUPAC name of 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde (CID 139331224) is 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde.
What is the SMILES notation for 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde?
The canonical SMILES for 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde is COC(C=O)(OC)c1c(Cl)ccnc1Cl.
What is the InChIKey of 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde?
The InChIKey is XFDDQORETRNHPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl2NO3/c1-14-9(5-13,15-2)7-6(10)3-4-12-8(7)11/h3-5H,1-2H3.
What are the key properties of 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde?
2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde has a molecular weight of 250.08 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichloro-3-pyridinyl)-2,2-dimethoxyacetaldehyde is sourced from PubChem (CID 139331224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).