About 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole
3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole (PubChem CID 139331400) has the molecular formula C10H8N4O
and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole |
| PubChem CID | 139331400 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole |
| SMILES | Cc1nocc1-c1ccc2cn[nH]c2n1 |
| InChI | InChI=1S/C10H8N4O/c1-6-8(5-15-14-6)9-3-2-7-4-11-13-10(7)12-9/h2-5H,1H3,(H,11,12,13) |
| InChIKey | DXYZNVYCUMLCMS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole?
The IUPAC name of 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole (CID 139331400) is 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole.
What is the SMILES notation for 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole?
The canonical SMILES for 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole is Cc1nocc1-c1ccc2cn[nH]c2n1.
What is the InChIKey of 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole?
The InChIKey is DXYZNVYCUMLCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O/c1-6-8(5-15-14-6)9-3-2-7-4-11-13-10(7)12-9/h2-5H,1H3,(H,11,12,13).
What are the key properties of 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole?
3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole has a molecular weight of 200.20 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(1H-pyrazolo[5,4-b]pyridin-6-yl)-1,2-oxazole is sourced from PubChem (CID 139331400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).