C12H14ClF3N2O — CID 139332064
2-(7-chloro-3-ethyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)-3,3,3-trifluoropropan-1-amine (PubChem CID 139332064) has the molecular formula C12H14ClF3N2O and a molecular weight of 294.70 g/mol. Its IUPAC name is 2-(7-chloro-3-ethyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 2-(7-chloro-3-ethyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 139332064 |
| Molecular Formula | C12H14ClF3N2O |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(7-chloro-3-ethyl-2,3-dihydrofuro[2,3-c]pyridin-5-yl)-3,3,3-trifluoropropan-1-amine |
| SMILES | CCC1COc2c1cc(C(CN)C(F)(F)F)nc2Cl |
| InChI | InChI=1S/C12H14ClF3N2O/c1-2-6-5-19-10-7(6)3-9(18-11(10)13)8(4-17)12(14,15)16/h3,6,8H,2,4-5,17H2,1H3 |
| InChIKey | IZUOVYUBUYJJTN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|