C20H27ClF3N3O4S — CID 139332080
tert-butyl (3S)-3-(tert-butylsulfinylamino)-7-chloro-3-methyl-5-[2-(trifluoromethyl)oxiran-2-yl]-2H-pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 139332080) has the molecular formula C20H27ClF3N3O4S and a molecular weight of 497.97 g/mol. Its IUPAC name is tert-butyl (3S)-3-(tert-butylsulfinylamino)-7-chloro-3-methyl-5-[2-(trifluoromethyl)oxiran-2-yl]-2H-pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(tert-butylsulfinylamino)-7-chloro-3-methyl-5-[2-(trifluoromethyl)oxiran-2-yl]-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 139332080 |
| Molecular Formula | C20H27ClF3N3O4S |
| Molecular Weight | 497.97 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | tert-butyl (3S)-3-(tert-butylsulfinylamino)-7-chloro-3-methyl-5-[2-(trifluoromethyl)oxiran-2-yl]-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@](C)(NS(=O)C(C)(C)C)c2cc(C3(C(F)(F)F)CO3)nc(Cl)c21 |
| InChI | InChI=1S/C20H27ClF3N3O4S/c1-16(2,3)31-15(28)27-9-18(7,26-32(29)17(4,5)6)11-8-12(25-14(21)13(11)27)19(10-30-19)20(22,23)24/h8,26H,9-10H2,1-7H3/t18-,19?,32?/m1/s1 |
| InChIKey | KDYSATGXLSOIHD-JANNNFCOSA-N |
| XLogP | 4.54 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.97 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|