C40H26FN9 — CID 139332223
4-[5-[2-(4-fluorophenyl)-3H-imidazo[4,5-f][1,10]phenanthrolin-5-yl]-1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl]-N,N-dimethylaniline (PubChem CID 139332223) has the molecular formula C40H26FN9 and a molecular weight of 651.71 g/mol. Its IUPAC name is 4-[5-[2-(4-fluorophenyl)-3H-imidazo[4,5-f][1,10]phenanthrolin-5-yl]-1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-[2-(4-fluorophenyl)-3H-imidazo[4,5-f][1,10]phenanthrolin-5-yl]-1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139332223 |
| Molecular Formula | C40H26FN9 |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 651.23 |
| IUPAC Name | 4-[5-[2-(4-fluorophenyl)-3H-imidazo[4,5-f][1,10]phenanthrolin-5-yl]-1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2nc3c4cc(-c5cnc6c(c5)c5[nH]c(-c7ccc(F)cc7)nc5c5cccnc56)cnc4c4ncccc4c3[nH]2)cc1 |
| InChI | InChI=1S/C40H26FN9/c1-50(2)26-13-9-22(10-14-26)40-47-36-28-6-4-16-43-32(28)34-30(38(36)49-40)18-24(20-45-34)23-17-29-33(44-19-23)31-27(5-3-15-42-31)35-37(29)48-39(46-35)21-7-11-25(41)12-8-21/h3-20H,1-2H3,(H,46,48)(H,47,49) |
| InChIKey | DRZOZTXXGBDQPW-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|