About N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide
N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide (PubChem CID 139332463) has the molecular formula C14H30N2S2
and a molecular weight of 290.54 g/mol. Its IUPAC name is N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide.
Molecular Properties
| Compound Name | N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide |
| PubChem CID | 139332463 |
| Molecular Formula | C14H30N2S2 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide |
| SMILES | CC/N=C(/N(C(C)(C)C)C(C)(C)C)C(C)(C)SS |
| InChI | InChI=1S/C14H30N2S2/c1-10-15-11(14(8,9)18-17)16(12(2,3)4)13(5,6)7/h17H,10H2,1-9H3/b15-11+ |
| InChIKey | HETNGRKFDBYQJO-RVDMUPIBSA-N |
| XLogP | 4.66 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide?
The IUPAC name of N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide (CID 139332463) is N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide.
What is the SMILES notation for N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide?
The canonical SMILES for N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide is CC/N=C(/N(C(C)(C)C)C(C)(C)C)C(C)(C)SS.
What is the InChIKey of N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide?
The InChIKey is HETNGRKFDBYQJO-RVDMUPIBSA-N. The full InChI is InChI=1S/C14H30N2S2/c1-10-15-11(14(8,9)18-17)16(12(2,3)4)13(5,6)7/h17H,10H2,1-9H3/b15-11+.
What are the key properties of N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide?
N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide has a molecular weight of 290.54 g/mol, XLogP of 4.66, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-ditert-butyl-2-(disulfanyl)-N'-ethyl-2-methylpropanimidamide is sourced from PubChem (CID 139332463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).